Products 887344-38-9

CAS 887344-38-9 appears in our catalog under these names: [2-(3,4-Dichlorophenyl)phenyl]sulfonyl chloride, 95%, (2-(3,4-Dichlorophenyl)phenyl)sulfonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-(3,4-dichlorophenyl)benzenesulfonyl chloride (CAS 887344-38-9) is a chemical compound with the molecular formula C12H7Cl3O2S and a molecular weight of 321.6 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)benzenesulfonyl chloride. InChIKey: NKNFGTZKGUVHGA-UHFFFAOYSA-N.

Identity
Molecular formulaC12H7Cl3O2S
Molecular weight321.6 g/mol
IUPAC name2-(3,4-dichlorophenyl)benzenesulfonyl chloride
InChIKeyNKNFGTZKGUVHGA-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=CC(=C(C=C2)Cl)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)