CAS 887344-38-9 appears in our catalog under these names: [2-(3,4-Dichlorophenyl)phenyl]sulfonyl chloride, 95%, (2-(3,4-Dichlorophenyl)phenyl)sulfonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
2-(3,4-dichlorophenyl)benzenesulfonyl chloride (CAS 887344-38-9) is a chemical compound with the molecular formula C12H7Cl3O2S and a molecular weight of 321.6 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)benzenesulfonyl chloride. InChIKey: NKNFGTZKGUVHGA-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl3O2S |
|---|---|
| Molecular weight | 321.6 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)benzenesulfonyl chloride |
| InChIKey | NKNFGTZKGUVHGA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=C(C=C2)Cl)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)