cas: 1505515-74-1 — see every product listed under this CAS number, including other names
(2-(4-(4,4,5,5-Tetramethyl-(1,3,2)dioxaborolan-2-yl)-phenoxy)-ethyl)-carbamic acid tert-butyl ester, 98% (CAS 1505515-74-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1160319-1g |
| cas | 1505515-74-1 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 8533.00 Pln | |
| AmBeed | 5g | 17842.30 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]carbamate (CAS 1505515-74-1) is a chemical compound with the molecular formula C19H30BNO5 and a molecular weight of 363.3 g/mol. IUPAC name: tert-butyl N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]carbamate. InChIKey: NGKGVDKSWLOSRW-UHFFFAOYSA-N.
| Molecular formula | C19H30BNO5 |
|---|---|
| Molecular weight | 363.3 g/mol |
| IUPAC name | tert-butyl N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]carbamate |
| InChIKey | NGKGVDKSWLOSRW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)