Products 1505516-19-7
CAS 1505516-19-7 appears in our catalog under these names: 3-[2-(Boc-amino)ethoxy]phenylboronic acid pinacol ester, 95%, 3-(2-(Boc-amino)ethoxy)phenylboronic Acid Pinacol Ester, 95%, 3-[2-(Boc-amino)ethoxy]phenylboronic Acid Pinacol Ester, >95%, >95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl N-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]carbamate (CAS 1505516-19-7) is a chemical compound with the molecular formula C19H30BNO5 and a molecular weight of 363.3 g/mol. IUPAC name: tert-butyl N-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]carbamate. InChIKey: GXCVCYPGZBKJQB-UHFFFAOYSA-N.
| Molecular formula | C19H30BNO5 |
|---|---|
| Molecular weight | 363.3 g/mol |
| IUPAC name | tert-butyl N-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]carbamate |
| InChIKey | GXCVCYPGZBKJQB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)OCCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)