cas: 284660-86-2 — see every product listed under this CAS number, including other names
(2-(Methoxycarbonyl)-1H-indol-5-yl)boronic acid 97% (CAS 284660-86-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A441388-50mg |
| cas | 284660-86-2 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 392.62 Pln | |
| Ambeed | 100mg | 464.94 Pln | |
| Ambeed | 250mg | 987.81 Pln | |
| Ambeed | 1g | 2873.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A441388 |
(2-methoxycarbonyl-1H-indol-5-yl)boronic acid (CAS 284660-86-2) is a chemical compound with the molecular formula C10H10BNO4 and a molecular weight of 219.00 g/mol. IUPAC name: (2-methoxycarbonyl-1H-indol-5-yl)boronic acid. InChIKey: CCQSNIWHVJIPJQ-UHFFFAOYSA-N.
| Molecular formula | C10H10BNO4 |
|---|---|
| Molecular weight | 219.00 g/mol |
| IUPAC name | (2-methoxycarbonyl-1H-indol-5-yl)boronic acid |
| InChIKey | CCQSNIWHVJIPJQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)NC(=C2)C(=O)OC)(O)O |
Computed by PubChem (NCBI)