cas: 284660-86-2 — see every product listed under this CAS number, including other names
(2-(Methoxycarbonyl)-1H-indol-5-yl)boronic acid, 98%, 98% (CAS 284660-86-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113VE4-50mg |
| cas | 284660-86-2 |
| size | 50mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 448.40 Pln | |
| Chemat | 100mg | 669.20 Pln | |
| Chemat | 250mg | 1082.00 Pln | |
| Chemat | 1g | 2824.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2-methoxycarbonyl-1H-indol-5-yl)boronic acid (CAS 284660-86-2) is a chemical compound with the molecular formula C10H10BNO4 and a molecular weight of 219.00 g/mol. IUPAC name: (2-methoxycarbonyl-1H-indol-5-yl)boronic acid. InChIKey: CCQSNIWHVJIPJQ-UHFFFAOYSA-N.
| Molecular formula | C10H10BNO4 |
|---|---|
| Molecular weight | 219.00 g/mol |
| IUPAC name | (2-methoxycarbonyl-1H-indol-5-yl)boronic acid |
| InChIKey | CCQSNIWHVJIPJQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)NC(=C2)C(=O)OC)(O)O |
Computed by PubChem (NCBI)