cas: 1451391-20-0 — see every product listed under this CAS number, including other names
(2-AMINO-3,4,5-TRIFLUOROPHENYL)BORONIC ACID PINACOL ESTER (CAS 1451391-20-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467251-1G |
| cas | 1451391-20-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2877.13 Pln | |
| Fluorochem | 5g | 8500.15 Pln |
| delivery time | 3-4 weeks |
|---|
2,3,4-trifluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 1451391-20-0) is a chemical compound with the molecular formula C12H15BF3NO2 and a molecular weight of 273.06 g/mol. IUPAC name: 2,3,4-trifluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: ZWFBPKFAOYRZNJ-UHFFFAOYSA-N.
| Molecular formula | C12H15BF3NO2 |
|---|---|
| Molecular weight | 273.06 g/mol |
| IUPAC name | 2,3,4-trifluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | ZWFBPKFAOYRZNJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2N)F)F)F |
Computed by PubChem (NCBI)