Products 1451391-20-0
CAS 1451391-20-0 appears in our catalog under these names: 2,3,4-trifluoro-6-(tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 95%, (2-AMINO-3,4,5-TRIFLUOROPHENYL)BORONIC ACID PINACOL ESTER. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 5g, 1g.
2,3,4-trifluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 1451391-20-0) is a chemical compound with the molecular formula C12H15BF3NO2 and a molecular weight of 273.06 g/mol. IUPAC name: 2,3,4-trifluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: ZWFBPKFAOYRZNJ-UHFFFAOYSA-N.
| Molecular formula | C12H15BF3NO2 |
|---|---|
| Molecular weight | 273.06 g/mol |
| IUPAC name | 2,3,4-trifluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | ZWFBPKFAOYRZNJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2N)F)F)F |
Computed by PubChem (NCBI)