cas: 943323-35-1 — see every product listed under this CAS number, including other names
(2-Amino-3-phenyl-propyl)-carbamic acid tert-butyl ester, 97% (CAS 943323-35-1) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F737217-500MG |
| cas | 943323-35-1 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 1841.04 Pln | |
| Fluorochem | 1g | 2720.93 Pln | |
| Fluorochem | 5g | 8000.33 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(2-amino-3-phenylpropyl)carbamate (CAS 943323-35-1) is a chemical compound with the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. IUPAC name: tert-butyl N-(2-amino-3-phenylpropyl)carbamate. InChIKey: ADVSLLRGGNVROC-UHFFFAOYSA-N.
| Molecular formula | C14H22N2O2 |
|---|---|
| Molecular weight | 250.34 g/mol |
| IUPAC name | tert-butyl N-(2-amino-3-phenylpropyl)carbamate |
| InChIKey | ADVSLLRGGNVROC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC(CC1=CC=CC=C1)N |
Computed by PubChem (NCBI)