Products 1185429-26-8

CAS 1185429-26-8 is the registry number for 1-(2-Methylphenyl)-1,4-diazepane acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.

Structural formula: {0} (CAS {1})

Acetic acid;1-(2-methylphenyl)-1,4-diazepane (CAS 1185429-26-8) is a chemical compound with the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. IUPAC name: acetic acid;1-(2-methylphenyl)-1,4-diazepane. InChIKey: ZDDGTSXUYOUZOS-UHFFFAOYSA-N.

Identity
Molecular formulaC14H22N2O2
Molecular weight250.34 g/mol
IUPAC nameacetic acid;1-(2-methylphenyl)-1,4-diazepane
InChIKeyZDDGTSXUYOUZOS-UHFFFAOYSA-N
SMILESCC1=CC=CC=C1N2CCCNCC2.CC(=O)O

Computed by PubChem (NCBI)