cas: 1072951-75-7 — see every product listed under this CAS number, including other names
(2-Bromo-6-fluoro-3-isopropoxyphenyl)boronic acid, 98% (CAS 1072951-75-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F338062-1G |
| cas | 1072951-75-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 419.66 Pln | |
| Fluorochem | 10g | 784.12 Pln | |
| Fluorochem | 25g | 1872.28 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2-bromo-6-fluoro-3-propan-2-yloxyphenyl)boronic acid (CAS 1072951-75-7) is a chemical compound with the molecular formula C9H11BBrFO3 and a molecular weight of 276.90 g/mol. IUPAC name: (2-bromo-6-fluoro-3-propan-2-yloxyphenyl)boronic acid. InChIKey: UVXVGFZUDLIHKI-UHFFFAOYSA-N.
| Molecular formula | C9H11BBrFO3 |
|---|---|
| Molecular weight | 276.90 g/mol |
| IUPAC name | (2-bromo-6-fluoro-3-propan-2-yloxyphenyl)boronic acid |
| InChIKey | UVXVGFZUDLIHKI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1Br)OC(C)C)F)(O)O |
Computed by PubChem (NCBI)