(2-Bromo-6-fluoro-3-isopropoxyphenyl)boronic acid, 98%
cas: 1072951-75-7 — see every product listed under this CAS number, including other names
(2-Bromo-6-fluoro-3-isopropoxyphenyl)boronic acid, 98% (CAS 1072951-75-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A245280-250mg |
| cas | 1072951-75-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 437.12 Pln | |
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 5g | 435.28 Pln | |
| Fluorochem | 10g | 820.56 Pln | |
| Fluorochem | 25g | 1945.17 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 208.84 Pln | |
| BLDpharm | 5g | 464.31 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2-bromo-6-fluoro-3-propan-2-yloxyphenyl)boronic acid (CAS 1072951-75-7) is a chemical compound with the molecular formula C9H11BBrFO3 and a molecular weight of 276.90 g/mol. IUPAC name: (2-bromo-6-fluoro-3-propan-2-yloxyphenyl)boronic acid. InChIKey: UVXVGFZUDLIHKI-UHFFFAOYSA-N.
| Molecular formula | C9H11BBrFO3 |
|---|---|
| Molecular weight | 276.90 g/mol |
| IUPAC name | (2-bromo-6-fluoro-3-propan-2-yloxyphenyl)boronic acid |
| InChIKey | UVXVGFZUDLIHKI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1Br)OC(C)C)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Bromo-6-fluoro-3-isopropoxyphenylboronic acid, (2-Bromo-6-fluoro-3-isopropoxyphenyl)boronic acid, (2-bromo-6-fluoro-3-propan-2-yloxyphenyl)boronic acid, (2-Bromo-6-fluoro-3-isopropoxy-phenyl)boronic acid, (2-Bromo-6-fluoro-3-isopropoxyphenyl)boronicacid, {2-Bromo-6-fluoro-3-[(propan-2-yl)oxy]phenyl}boronic acid