CAS 1072951-85-9 appears in our catalog under these names: (6–Bromo–2–fluoro–3–propoxyphenyl)boronic acid, 6-Bromo-2-fluoro-3-propoxyphenylboronic acid, 95%, 95%, (6-Bromo-2-fluoro-3-propoxyphenyl)boronic acid, 99%(LC-MS),RG, (6-Bromo-2-fluoro-3-propoxyphenyl)boronic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 25g.
(6-bromo-2-fluoro-3-propoxyphenyl)boronic acid (CAS 1072951-85-9) is a chemical compound with the molecular formula C9H11BBrFO3 and a molecular weight of 276.90 g/mol. IUPAC name: (6-bromo-2-fluoro-3-propoxyphenyl)boronic acid. InChIKey: NRFJKFUWHJKBRV-UHFFFAOYSA-N.
| Molecular formula | C9H11BBrFO3 |
|---|---|
| Molecular weight | 276.90 g/mol |
| IUPAC name | (6-bromo-2-fluoro-3-propoxyphenyl)boronic acid |
| InChIKey | NRFJKFUWHJKBRV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)OCCC)Br)(O)O |
Computed by PubChem (NCBI)