cas: 1029649-46-4 — see every product listed under this CAS number, including other names
(2-Chloro-4-(trifluoromethyl)phenyl)hydrazine hydrochloride, 98%, 98% (CAS 1029649-46-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1146XF-1g |
| cas | 1029649-46-4 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 870.80 Pln | |
| Chemat | 25g | 3290.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[2-chloro-4-(trifluoromethyl)phenyl]hydrazine;hydrochloride (CAS 1029649-46-4) is a chemical compound with the molecular formula C7H7Cl2F3N2 and a molecular weight of 247.04 g/mol. IUPAC name: [2-chloro-4-(trifluoromethyl)phenyl]hydrazine;hydrochloride. InChIKey: IPMASRPDUAIXJX-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2F3N2 |
|---|---|
| Molecular weight | 247.04 g/mol |
| IUPAC name | [2-chloro-4-(trifluoromethyl)phenyl]hydrazine;hydrochloride |
| InChIKey | IPMASRPDUAIXJX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Cl)NN.Cl |
Computed by PubChem (NCBI)