CAS 502496-20-0 appears in our catalog under these names: 4-Chloro-2-(trifluoromethyl)phenylhydrazine hydrochloride, 98%, 4-Chloro-2-(trifluoromethyl)phenylhydrazine hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 5g.
[4-chloro-2-(trifluoromethyl)phenyl]hydrazine;hydrochloride (CAS 502496-20-0) is a chemical compound with the molecular formula C7H7Cl2F3N2 and a molecular weight of 247.04 g/mol. IUPAC name: [4-chloro-2-(trifluoromethyl)phenyl]hydrazine;hydrochloride. InChIKey: JAMOEYAUPWJGNO-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2F3N2 |
|---|---|
| Molecular weight | 247.04 g/mol |
| IUPAC name | [4-chloro-2-(trifluoromethyl)phenyl]hydrazine;hydrochloride |
| InChIKey | JAMOEYAUPWJGNO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(F)(F)F)NN.Cl |
Computed by PubChem (NCBI)