cas: 2036084-49-6 — see every product listed under this CAS number, including other names
(2-Chloro-6-(trifluoromethoxy)phenyl)boronic acid 98% (CAS 2036084-49-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A669284-1g |
| cas | 2036084-49-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 1616.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A669284 |
[2-chloro-6-(trifluoromethoxy)phenyl]boronic acid (CAS 2036084-49-6) is a chemical compound with the molecular formula C7H5BClF3O3 and a molecular weight of 240.37 g/mol. IUPAC name: [2-chloro-6-(trifluoromethoxy)phenyl]boronic acid. InChIKey: WUZKMKCNEQHESS-UHFFFAOYSA-N.
| Molecular formula | C7H5BClF3O3 |
|---|---|
| Molecular weight | 240.37 g/mol |
| IUPAC name | [2-chloro-6-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | WUZKMKCNEQHESS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1Cl)OC(F)(F)F)(O)O |
Computed by PubChem (NCBI)