CAS 902757-07-7 appears in our catalog under these names: 4-chloro-3-trifluoromethoxyphenylboronic acid, 98%, (4-Chloro-3-(trifluoromethoxy)phenyl)boronic acid, (4-Chloro-3-(trifluoromethoxy)phenyl)boronic acid, 98+%, 98+%, (4-Chloro-3-(trifluoromethoxy)phenyl)boronic acid, 97%, (4-Chloro-3-(trifluoromethoxy)phenyl)boronic acid, 98+%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 2,5g, 100mg.
[4-chloro-3-(trifluoromethoxy)phenyl]boronic acid (CAS 902757-07-7) is a chemical compound with the molecular formula C7H5BClF3O3 and a molecular weight of 240.37 g/mol. IUPAC name: [4-chloro-3-(trifluoromethoxy)phenyl]boronic acid. InChIKey: ZTIWEYMDQDWLHC-UHFFFAOYSA-N.
| Molecular formula | C7H5BClF3O3 |
|---|---|
| Molecular weight | 240.37 g/mol |
| IUPAC name | [4-chloro-3-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | ZTIWEYMDQDWLHC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)OC(F)(F)F)(O)O |
Computed by PubChem (NCBI)