cas: 333408-48-3 — see every product listed under this CAS number, including other names
(2-Chloro-7-methoxyquinolin-3-yl)methanol 95+% (CAS 333408-48-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A227631-100mg |
| cas | 333408-48-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 437.12 Pln | |
| Ambeed | 250mg | 670.75 Pln | |
| Ambeed | 1g | 1588.56 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A227631 |
(2-chloro-7-methoxyquinolin-3-yl)methanol (CAS 333408-48-3) is a chemical compound with the molecular formula C11H10ClNO2 and a molecular weight of 223.65 g/mol. IUPAC name: (2-chloro-7-methoxyquinolin-3-yl)methanol. InChIKey: VZILTDJTOMNDTH-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO2 |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | (2-chloro-7-methoxyquinolin-3-yl)methanol |
| InChIKey | VZILTDJTOMNDTH-UHFFFAOYSA-N |
| SMILES | COC1=CC2=NC(=C(C=C2C=C1)CO)Cl |
Computed by PubChem (NCBI)