cas: 333408-48-3 — see every product listed under this CAS number, including other names
(2-Chloro-7-methoxyquinolin-3-yl)methanol (CAS 333408-48-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F724812-250MG |
| cas | 333408-48-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1028.82 Pln | |
| Fluorochem | 1g | 2809.45 Pln |
| delivery time | 3-4 weeks |
|---|
(2-chloro-7-methoxyquinolin-3-yl)methanol (CAS 333408-48-3) is a chemical compound with the molecular formula C11H10ClNO2 and a molecular weight of 223.65 g/mol. IUPAC name: (2-chloro-7-methoxyquinolin-3-yl)methanol. InChIKey: VZILTDJTOMNDTH-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO2 |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | (2-chloro-7-methoxyquinolin-3-yl)methanol |
| InChIKey | VZILTDJTOMNDTH-UHFFFAOYSA-N |
| SMILES | COC1=CC2=NC(=C(C=C2C=C1)CO)Cl |
Computed by PubChem (NCBI)