cas: 1165936-03-7 — see every product listed under this CAS number, including other names
(2-FLUORO-4-METHYLPHENYL)BORONIC ACID PINACOL ESTER, 97% (CAS 1165936-03-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F473983-250MG |
| cas | 1165936-03-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 445.69 Pln | |
| Fluorochem | 25g | 1606.74 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(2-fluoro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1165936-03-7) is a chemical compound with the molecular formula C13H18BFO2 and a molecular weight of 236.09 g/mol. IUPAC name: 2-(2-fluoro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: MKWDECBHRFNFGY-UHFFFAOYSA-N.
| Molecular formula | C13H18BFO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | 2-(2-fluoro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | MKWDECBHRFNFGY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C)F |
Computed by PubChem (NCBI)