CAS 1310048-95-3 appears in our catalog under these names: 3-Fluorophenylmethylboronic acid pinacol ester, 95%, 3-Fluorophenylmethylboronic acid pinacol ester, 2-(3-Fluorobenzyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, (3-Fluorobenzyl)boronic acid pinacol ester, 97%, 2-(3-Fluorobenzyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98%. Offered by: Combi-blocks, TRC, Biosynth, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, 50mg, 2g, 100mg.
2-[(3-fluorophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1310048-95-3) is a chemical compound with the molecular formula C13H18BFO2 and a molecular weight of 236.09 g/mol. IUPAC name: 2-[(3-fluorophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: LIQLVQAWDJTUIM-UHFFFAOYSA-N.
| Molecular formula | C13H18BFO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | 2-[(3-fluorophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | LIQLVQAWDJTUIM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)