cas: 874289-42-6 — see every product listed under this CAS number, including other names
(2-Fluoro-5-(pyrrolidine-1-carbonyl)phenyl)boronic acid 98% (CAS 874289-42-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A622594-250mg |
| cas | 874289-42-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 587.31 Pln | |
| Ambeed | 5g | 2144.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A622594 |
[2-fluoro-5-(pyrrolidine-1-carbonyl)phenyl]boronic acid (CAS 874289-42-6) is a chemical compound with the molecular formula C11H13BFNO3 and a molecular weight of 237.04 g/mol. IUPAC name: [2-fluoro-5-(pyrrolidine-1-carbonyl)phenyl]boronic acid. InChIKey: LUWFRPUCEBPJIZ-UHFFFAOYSA-N.
| Molecular formula | C11H13BFNO3 |
|---|---|
| Molecular weight | 237.04 g/mol |
| IUPAC name | [2-fluoro-5-(pyrrolidine-1-carbonyl)phenyl]boronic acid |
| InChIKey | LUWFRPUCEBPJIZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)N2CCCC2)F)(O)O |
Computed by PubChem (NCBI)