cas: 874289-42-6 — see every product listed under this CAS number, including other names
(2-Fluoro-5-(pyrrolidine-1-carbonyl)phenyl)boronic acid (CAS 874289-42-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216209-1G |
| cas | 874289-42-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1440.14 Pln | |
| Fluorochem | 5g | 4157.93 Pln |
| delivery time | 3-4 weeks |
|---|
[2-fluoro-5-(pyrrolidine-1-carbonyl)phenyl]boronic acid (CAS 874289-42-6) is a chemical compound with the molecular formula C11H13BFNO3 and a molecular weight of 237.04 g/mol. IUPAC name: [2-fluoro-5-(pyrrolidine-1-carbonyl)phenyl]boronic acid. InChIKey: LUWFRPUCEBPJIZ-UHFFFAOYSA-N.
| Molecular formula | C11H13BFNO3 |
|---|---|
| Molecular weight | 237.04 g/mol |
| IUPAC name | [2-fluoro-5-(pyrrolidine-1-carbonyl)phenyl]boronic acid |
| InChIKey | LUWFRPUCEBPJIZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)N2CCCC2)F)(O)O |
Computed by PubChem (NCBI)