cas: 259209-17-1 — see every product listed under this CAS number, including other names
(2-Hydroxy-3-methoxyphenyl)boronic acid, 96% (CAS 259209-17-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F694023-5G |
| cas | 259209-17-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 758.08 Pln | |
| Fluorochem | 10g | 1419.31 Pln | |
| Fluorochem | 25g | 3309.27 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
(2-hydroxy-3-methoxyphenyl)boronic acid (CAS 259209-17-1) is a chemical compound with the molecular formula C7H9BO4 and a molecular weight of 167.96 g/mol. IUPAC name: (2-hydroxy-3-methoxyphenyl)boronic acid. InChIKey: BTYZWLYIOSFCJX-UHFFFAOYSA-N.
| Molecular formula | C7H9BO4 |
|---|---|
| Molecular weight | 167.96 g/mol |
| IUPAC name | (2-hydroxy-3-methoxyphenyl)boronic acid |
| InChIKey | BTYZWLYIOSFCJX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)OC)O)(O)O |
Computed by PubChem (NCBI)