CAS 550373-98-3 is the registry number for (4-Hydroxy-2-methoxyphenyl)boronic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
(4-hydroxy-2-methoxyphenyl)boronic acid (CAS 550373-98-3) is a chemical compound with the molecular formula C7H9BO4 and a molecular weight of 167.96 g/mol. IUPAC name: (4-hydroxy-2-methoxyphenyl)boronic acid. InChIKey: CUJHXROTYXHSEX-UHFFFAOYSA-N.
| Molecular formula | C7H9BO4 |
|---|---|
| Molecular weight | 167.96 g/mol |
| IUPAC name | (4-hydroxy-2-methoxyphenyl)boronic acid |
| InChIKey | CUJHXROTYXHSEX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)O)OC)(O)O |
Computed by PubChem (NCBI)