CAS 55894-16-1 appears in our catalog under these names: (2-Methoxyethyl)triphenylphosphonium Bromide, (2–Methoxyethyl)triphenylphosphonium bromide, (2-Methoxyethyl)triphenylphosphonium bromide, 97%, 97%, (2-Methoxyethyl)triphenylphosphonium bromide, 97%, (2-Methoxyethyl)triphenylphosphonium bromide, 95%. Offered by: TRC, GLPBio, Chemat, Ambeed, Fluorochem. Available pack sizes: 10g, 100g, 25g, 5g, 250mg, 1g, 100mg, 500g.
2-methoxyethyl(triphenyl)phosphanium bromide (CAS 55894-16-1) is a chemical compound with the molecular formula C21H22BrOP and a molecular weight of 401.3 g/mol. IUPAC name: 2-methoxyethyl(triphenyl)phosphanium bromide. InChIKey: TZSFISGIOFHBOJ-UHFFFAOYSA-M.
| Molecular formula | C21H22BrOP |
|---|---|
| Molecular weight | 401.3 g/mol |
| IUPAC name | 2-methoxyethyl(triphenyl)phosphanium bromide |
| InChIKey | TZSFISGIOFHBOJ-UHFFFAOYSA-M |
| SMILES | COCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)