CAS 51860-45-8 appears in our catalog under these names: Olopatadine Impurity 43, (3-Hydroxypropyl)triphenylphosphonium bromide 95+%, (3-Hydroxypropyl)triphenylphosphonium bromide, 95%+, 95%+. Offered by: Chemat Brand, Ambeed, Chemat. Available pack sizes: on request, 250mg, 1g, 100mg, 5g, 10g.
3-hydroxypropyl(triphenyl)phosphanium bromide (CAS 51860-45-8) is a chemical compound with the molecular formula C21H22BrOP and a molecular weight of 401.3 g/mol. IUPAC name: 3-hydroxypropyl(triphenyl)phosphanium bromide. InChIKey: AHYDCPUKEAXCKZ-UHFFFAOYSA-M.
| Molecular formula | C21H22BrOP |
|---|---|
| Molecular weight | 401.3 g/mol |
| IUPAC name | 3-hydroxypropyl(triphenyl)phosphanium bromide |
| InChIKey | AHYDCPUKEAXCKZ-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)[P+](CCCO)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)