cas: 590417-67-7 — see every product listed under this CAS number, including other names
(2-Methylbenzo[d]thiazol-5-yl)boronic acid, 98% (CAS 590417-67-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F447738-100MG |
| cas | 590417-67-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 221.81 Pln | |
| Fluorochem | 250mg | 227.02 Pln | |
| Fluorochem | 1g | 476.93 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2-methyl-1,3-benzothiazol-5-yl)boronic acid (CAS 590417-67-7) is a chemical compound with the molecular formula C8H8BNO2S and a molecular weight of 193.04 g/mol. IUPAC name: (2-methyl-1,3-benzothiazol-5-yl)boronic acid. InChIKey: XFPZHJXTRXAWAO-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO2S |
|---|---|
| Molecular weight | 193.04 g/mol |
| IUPAC name | (2-methyl-1,3-benzothiazol-5-yl)boronic acid |
| InChIKey | XFPZHJXTRXAWAO-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)SC(=N2)C)(O)O |
Computed by PubChem (NCBI)