CAS 590417-67-7 appears in our catalog under these names: 2-Methylbenzothiazole-5-boronic acid, 96%, (2–Methylbenzo(d)thiazol–5–yl)boronic acid, (2-Methylbenzo[d]thiazol-5-yl)boronic acid 98+%, 2-METHYLBENZOTHIAZOLE-5-BORONIC ACID, 98%, 98%, (2-Methylbenzo[d]thiazol-5-yl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg.
(2-methyl-1,3-benzothiazol-5-yl)boronic acid (CAS 590417-67-7) is a chemical compound with the molecular formula C8H8BNO2S and a molecular weight of 193.04 g/mol. IUPAC name: (2-methyl-1,3-benzothiazol-5-yl)boronic acid. InChIKey: XFPZHJXTRXAWAO-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO2S |
|---|---|
| Molecular weight | 193.04 g/mol |
| IUPAC name | (2-methyl-1,3-benzothiazol-5-yl)boronic acid |
| InChIKey | XFPZHJXTRXAWAO-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)SC(=N2)C)(O)O |
Computed by PubChem (NCBI)