cas: 63591-79-7 — see every product listed under this CAS number, including other names
(2-Methylquinolin-4-yl)(piperazin-1-yl)methanone, 95% (CAS 63591-79-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F689069-100MG |
| cas | 63591-79-7 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 841.39 Pln | |
| Fluorochem | 250mg | 1367.24 Pln | |
| Fluorochem | 500mg | 2247.14 Pln | |
| Fluorochem | 1g | 2648.04 Pln | |
| Fluorochem | 5g | 7385.96 Pln | |
| Fluorochem | 10g | 12503.95 Pln | |
| Chemat | 100mg | 654.80 Pln | |
| Chemat | 250mg | 1058.00 Pln | |
| Chemat | 1g | 2056.40 Pln | |
| Chemat | 5g | 4821.20 Pln | |
| Chemat | 10g | 7446.80 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(2-methylquinolin-4-yl)-piperazin-1-ylmethanone (CAS 63591-79-7) is a chemical compound with the molecular formula C15H17N3O and a molecular weight of 255.31 g/mol. IUPAC name: (2-methylquinolin-4-yl)-piperazin-1-ylmethanone. InChIKey: UCVGPJNXQYJZMA-UHFFFAOYSA-N.
| Molecular formula | C15H17N3O |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | (2-methylquinolin-4-yl)-piperazin-1-ylmethanone |
| InChIKey | UCVGPJNXQYJZMA-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC=CC=C2C(=C1)C(=O)N3CCNCC3 |
Computed by PubChem (NCBI)