CAS 1224164-52-6 is the registry number for 3-Amino-4-(dimethylamino)-N-phenylbenzamide dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-amino-4-(dimethylamino)-N-phenylbenzamide (CAS 1224164-52-6) is a chemical compound with the molecular formula C15H17N3O and a molecular weight of 255.31 g/mol. IUPAC name: 3-amino-4-(dimethylamino)-N-phenylbenzamide. InChIKey: VNILCBBQUZOUGT-UHFFFAOYSA-N.
| Molecular formula | C15H17N3O |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | 3-amino-4-(dimethylamino)-N-phenylbenzamide |
| InChIKey | VNILCBBQUZOUGT-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=C1)C(=O)NC2=CC=CC=C2)N |
Computed by PubChem (NCBI)