cas: 2165961-82-8 — see every product listed under this CAS number, including other names
(2R)-1-[(tert-butoxy)carbonyl]-3,3-difluoropyrrolidine-2-carboxylic acid, 95%, 95% (CAS 2165961-82-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KLR2-1g |
| cas | 2165961-82-8 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 3501.20 Pln | |
| Chemat | 5g | 10360.40 Pln | |
| Chemat | 10g | 19696.40 Pln | |
| Chemat | 25g | 39318.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R)-3,3-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 2165961-82-8) is a chemical compound with the molecular formula C10H15F2NO4 and a molecular weight of 251.23 g/mol. IUPAC name: (2R)-3,3-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: KYKGTPMAQQHAOU-ZCFIWIBFSA-N.
| Molecular formula | C10H15F2NO4 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | (2R)-3,3-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | KYKGTPMAQQHAOU-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC([C@H]1C(=O)O)(F)F |
Computed by PubChem (NCBI)