CAS 1781091-41-5 is the registry number for 2-{1-((tert-butoxy)carbonyl)azetidin-3-yl}-2,2-difluoroacetic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2,2-difluoro-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]acetic acid (CAS 1781091-41-5) is a chemical compound with the molecular formula C10H15F2NO4 and a molecular weight of 251.23 g/mol. IUPAC name: 2,2-difluoro-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]acetic acid. InChIKey: YNJIFLFCTIIZIN-UHFFFAOYSA-N.
| Molecular formula | C10H15F2NO4 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | 2,2-difluoro-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]acetic acid |
| InChIKey | YNJIFLFCTIIZIN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)