cas: 1213907-32-4 — see every product listed under this CAS number, including other names
(2R)-2-(2-Isopropylphenyl)pyrrolidine, 95% (CAS 1213907-32-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12JUMO-100mg |
| cas | 1213907-32-4 |
| size | 100mg |
| availability | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 832.40 Pln | |
| Chemat | 250mg | 1298.00 Pln | |
| Chemat | 500mg | 2118.80 Pln | |
| Chemat | 1g | 3150.80 Pln | |
| Chemat | 5g | 9323.60 Pln | |
| Fluorochem | 100mg | 1549.47 Pln | |
| Fluorochem | 250mg | 2403.34 Pln | |
| Fluorochem | 500mg | 3918.43 Pln | |
| Fluorochem | 1g | 5850.04 Pln | |
| Fluorochem | 5g | 17023.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-(2-propan-2-ylphenyl)pyrrolidine (CAS 1213907-32-4) is a chemical compound with the molecular formula C13H19N and a molecular weight of 189.30 g/mol. IUPAC name: (2R)-2-(2-propan-2-ylphenyl)pyrrolidine. InChIKey: BOHFZXYLEIZSCX-CYBMUJFWSA-N.
| Molecular formula | C13H19N |
|---|---|
| Molecular weight | 189.30 g/mol |
| IUPAC name | (2R)-2-(2-propan-2-ylphenyl)pyrrolidine |
| InChIKey | BOHFZXYLEIZSCX-CYBMUJFWSA-N |
| SMILES | CC(C)C1=CC=CC=C1[C@H]2CCCN2 |
Computed by PubChem (NCBI)