cas: 186293-54-9 — see every product listed under this CAS number, including other names
(2R)-2-(Chloromethyl)-4-(phenylmethyl)morpholine 95% (CAS 186293-54-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A535222-250mg |
| cas | 186293-54-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 1082.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A535222 |
(2R)-4-benzyl-2-(chloromethyl)morpholine (CAS 186293-54-9) is a chemical compound with the molecular formula C12H16ClNO and a molecular weight of 225.71 g/mol. IUPAC name: (2R)-4-benzyl-2-(chloromethyl)morpholine. InChIKey: GVWRZZNYCOTWNN-LBPRGKRZSA-N.
| Molecular formula | C12H16ClNO |
|---|---|
| Molecular weight | 225.71 g/mol |
| IUPAC name | (2R)-4-benzyl-2-(chloromethyl)morpholine |
| InChIKey | GVWRZZNYCOTWNN-LBPRGKRZSA-N |
| SMILES | C1CO[C@H](CN1CC2=CC=CC=C2)CCl |
Computed by PubChem (NCBI)