Products 69245-90-5
CAS 69245-90-5 is the registry number for 2-Chloro-4-(piperidin-1-ylmethyl)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-chloro-4-(piperidin-1-ylmethyl)phenol (CAS 69245-90-5) is a chemical compound with the molecular formula C12H16ClNO and a molecular weight of 225.71 g/mol. IUPAC name: 2-chloro-4-(piperidin-1-ylmethyl)phenol. InChIKey: NZYVTXMMWGRQNR-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO |
|---|---|
| Molecular weight | 225.71 g/mol |
| IUPAC name | 2-chloro-4-(piperidin-1-ylmethyl)phenol |
| InChIKey | NZYVTXMMWGRQNR-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CC2=CC(=C(C=C2)O)Cl |
Computed by PubChem (NCBI)