cas: 25129-20-8 — see every product listed under this CAS number, including other names
(2R,2'R)-3,3'-Disulfanediylbis(2-benzamidopropanoic acid), 98%, 98% (CAS 25129-20-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113QKJ-100mg |
| cas | 25129-20-8 |
| size | 100mg |
| availability | 125g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 213.20 Pln | |
| Chemat | 5g | 606.80 Pln | |
| Chemat | 10g | 1110.80 Pln | |
| Chemat | 25g | 2397.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-benzamido-3-[[(2R)-2-benzamido-2-carboxyethyl]disulfanyl]propanoic acid (CAS 25129-20-8) is a chemical compound with the molecular formula C20H20N2O6S2 and a molecular weight of 448.5 g/mol. IUPAC name: (2R)-2-benzamido-3-[[(2R)-2-benzamido-2-carboxyethyl]disulfanyl]propanoic acid. InChIKey: GUTXMPQWQSOAIY-HOTGVXAUSA-N.
| Molecular formula | C20H20N2O6S2 |
|---|---|
| Molecular weight | 448.5 g/mol |
| IUPAC name | (2R)-2-benzamido-3-[[(2R)-2-benzamido-2-carboxyethyl]disulfanyl]propanoic acid |
| InChIKey | GUTXMPQWQSOAIY-HOTGVXAUSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N[C@@H](CSSC[C@@H](C(=O)O)NC(=O)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)