CAS 25129-20-8 appears in our catalog under these names: N,N'-Dibenzoyl-l-cystine, 95%, (2R,2'R)-3,3'-Disulfanediylbis(2-benzamidopropanoic acid), 95%, N,N′–Dibenzoyl–L–cystine, N,N'-DIBENZOYL-L-CYSTINE, 98%, (2R,2'R)-3,3'-Disulfanediylbis(2-benzamidopropanoic acid), 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, 100mg.
(2R)-2-benzamido-3-[[(2R)-2-benzamido-2-carboxyethyl]disulfanyl]propanoic acid (CAS 25129-20-8) is a chemical compound with the molecular formula C20H20N2O6S2 and a molecular weight of 448.5 g/mol. IUPAC name: (2R)-2-benzamido-3-[[(2R)-2-benzamido-2-carboxyethyl]disulfanyl]propanoic acid. InChIKey: GUTXMPQWQSOAIY-HOTGVXAUSA-N.
| Molecular formula | C20H20N2O6S2 |
|---|---|
| Molecular weight | 448.5 g/mol |
| IUPAC name | (2R)-2-benzamido-3-[[(2R)-2-benzamido-2-carboxyethyl]disulfanyl]propanoic acid |
| InChIKey | GUTXMPQWQSOAIY-HOTGVXAUSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N[C@@H](CSSC[C@@H](C(=O)O)NC(=O)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)