(2R,3R,4R,5R,6R)-5-Acetamido-2-(acetoxymethyl)-6-((1-azido-13-oxo-3,6,9-trioxa-12-azaheptadecan-17-yl)oxy)tetrahydro-2H-pyran-3,4-diyl diacetate, 95%
cas: 1840885-93-9 — see every product listed under this CAS number, including other names
(2R,3R,4R,5R,6R)-5-Acetamido-2-(acetoxymethyl)-6-((1-azido-13-oxo-3,6,9-trioxa-12-azaheptadecan-17-yl)oxy)tetrahydro-2H-pyran-3,4-diyl diacetate, 95% (CAS 1840885-93-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1GZDDJ-50mg |
| cas | 1840885-93-9 |
| size | 50mg |
| availability | 2g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 1451.60 Pln | |
| Chemat | 100mg | 2421.20 Pln | |
| Chemat | 250mg | 4197.20 Pln | |
| Chemat | 1g | 10485.20 Pln | |
| Fluorochem | 50mg | 1898.31 Pln | |
| Fluorochem | 100mg | 3184.31 Pln | |
| Fluorochem | 250mg | 5490.79 Pln | |
| Fluorochem | 1g | 13102.70 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[5-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]-5-oxopentoxy]oxan-2-yl]methyl acetate (CAS 1840885-93-9) is a chemical compound with the molecular formula C27H45N5O13 and a molecular weight of 647.7 g/mol. IUPAC name: [(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[5-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]-5-oxopentoxy]oxan-2-yl]methyl acetate. InChIKey: QNFPXEJMQNROBJ-UIKHAHSZSA-N.
| Molecular formula | C27H45N5O13 |
|---|---|
| Molecular weight | 647.7 g/mol |
| IUPAC name | [(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[5-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]-5-oxopentoxy]oxan-2-yl]methyl acetate |
| InChIKey | QNFPXEJMQNROBJ-UIKHAHSZSA-N |
| SMILES | CC(=O)N[C@@H]1[C@H]([C@H]([C@H](O[C@H]1OCCCCC(=O)NCCOCCOCCOCCN=[N+]=[N-])COC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)