cas: 14581-81-8 — see every product listed under this CAS number, including other names
(2R,3R,4S,5R,6S)-2-(Acetoxymethyl)-6-(4-methoxyphenoxy)tetrahydro-2H-pyran-3,4,5-triyl triacetate, 98%, 98% (CAS 14581-81-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112DG9-1g |
| cas | 14581-81-8 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 184.40 Pln | |
| Chemat | 10g | 285.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-methoxyphenoxy)oxan-2-yl]methyl acetate (CAS 14581-81-8) is a chemical compound with the molecular formula C21H26O11 and a molecular weight of 454.4 g/mol. IUPAC name: [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-methoxyphenoxy)oxan-2-yl]methyl acetate. InChIKey: RPHXBVOPPUTUES-YMQHIKHWSA-N.
| Molecular formula | C21H26O11 |
|---|---|
| Molecular weight | 454.4 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-methoxyphenoxy)oxan-2-yl]methyl acetate |
| InChIKey | RPHXBVOPPUTUES-YMQHIKHWSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC2=CC=C(C=C2)OC)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)