(2R,3S)-2-((R)-1-(3,5-Bis(trifluoromethyl)phenyl)ethoxy)-3-(4-fluorophenyl)morpholine hydrochloride 97%
cas: 171482-05-6 — see every product listed under this CAS number, including other names
(2R,3S)-2-((R)-1-(3,5-Bis(trifluoromethyl)phenyl)ethoxy)-3-(4-fluorophenyl)morpholine hydrochloride 97% (CAS 171482-05-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A113770-100mg |
| cas | 171482-05-6 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 181.25 Pln | |
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 264.69 Pln | |
| Ambeed | 5g | 565.06 Pln | |
| Ambeed | 10g | 1037.88 Pln | |
| Ambeed | 25g | 1538.50 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A113770 |
(2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholine;hydrochloride (CAS 171482-05-6) is a chemical compound with the molecular formula C20H19ClF7NO2 and a molecular weight of 473.8 g/mol. IUPAC name: (2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholine;hydrochloride. InChIKey: DWCCMKXSGCKMJF-YNXGUESPSA-N.
| Molecular formula | C20H19ClF7NO2 |
|---|---|
| Molecular weight | 473.8 g/mol |
| IUPAC name | (2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholine;hydrochloride |
| InChIKey | DWCCMKXSGCKMJF-YNXGUESPSA-N |
| SMILES | C[C@H](C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)O[C@@H]2[C@@H](NCCO2)C3=CC=C(C=C3)F.Cl |
Computed by PubChem (NCBI)