cas: 87421-23-6 — see every product listed under this CAS number, including other names
(2R,3S)-2-Amino-3-hydroxy-4-methylpentanoic acid, 97%, 97% (CAS 87421-23-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115GE3-50mg |
| cas | 87421-23-6 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 587.60 Pln | |
| Chemat | 100mg | 909.20 Pln | |
| Chemat | 250mg | 1475.60 Pln | |
| Chemat | 1g | 3539.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R,3S)-2-amino-3-hydroxy-4-methylpentanoic acid (CAS 87421-23-6) is a chemical compound with the molecular formula C6H13NO3 and a molecular weight of 147.17 g/mol. IUPAC name: (2R,3S)-2-amino-3-hydroxy-4-methylpentanoic acid. InChIKey: ZAYJDMWJYCTABM-UHNVWZDZSA-N.
| Molecular formula | C6H13NO3 |
|---|---|
| Molecular weight | 147.17 g/mol |
| IUPAC name | (2R,3S)-2-amino-3-hydroxy-4-methylpentanoic acid |
| InChIKey | ZAYJDMWJYCTABM-UHNVWZDZSA-N |
| SMILES | CC(C)[C@@H]([C@H](C(=O)O)N)O |
Computed by PubChem (NCBI)