Products 5817-22-1

CAS 5817-22-1 is the registry number for (2S,3S)-(2S,3R)-2-Amino-3-hydroxy-4-methylpentanoic Acid Hydrochloride Salt. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

(2S,3S)-2-amino-3-hydroxy-4-methylpentanoic acid (CAS 5817-22-1) is a chemical compound with the molecular formula C6H13NO3 and a molecular weight of 147.17 g/mol. IUPAC name: (2S,3S)-2-amino-3-hydroxy-4-methylpentanoic acid. InChIKey: ZAYJDMWJYCTABM-WHFBIAKZSA-N.

Identity
Molecular formulaC6H13NO3
Molecular weight147.17 g/mol
IUPAC name(2S,3S)-2-amino-3-hydroxy-4-methylpentanoic acid
InChIKeyZAYJDMWJYCTABM-WHFBIAKZSA-N
SMILESCC(C)[C@@H]([C@@H](C(=O)O)N)O

Computed by PubChem (NCBI)