Products 190315-43-6
CAS 190315-43-6 appears in our catalog under these names: 1,4-Dideoxy-1,4-epithio-D-ribitol/ 99.76% (existing batch purity), 1,4-Dideoxy-1,4-epithio-D-ribitol, 1，4-Dideoxy-1，4-epithio-D-ribitol, (2R,3S,4R)-2-(Hydroxymethyl)tetrahydrothiophene-3,4-diol, 98.74%, (2R,3S,4R)-2-(Hydroxymethyl)tetrahydrothiophene-3,4-diol, 97%. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress, Ambeed. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 0,5g.
(2R,3S,4R)-2-(hydroxymethyl)thiolane-3,4-diol (CAS 190315-43-6) is a chemical compound with the molecular formula C5H10O3S and a molecular weight of 150.20 g/mol. IUPAC name: (2R,3S,4R)-2-(hydroxymethyl)thiolane-3,4-diol. InChIKey: VLVSFIRYIVAVKW-LMVFSUKVSA-N.
| Molecular formula | C5H10O3S |
|---|---|
| Molecular weight | 150.20 g/mol |
| IUPAC name | (2R,3S,4R)-2-(hydroxymethyl)thiolane-3,4-diol |
| InChIKey | VLVSFIRYIVAVKW-LMVFSUKVSA-N |
| SMILES | C1[C@@H]([C@@H]([C@H](S1)CO)O)O |
Computed by PubChem (NCBI)