CAS 2714417-29-3 is the registry number for 2-Hydroxy-4-(methylsulfanyl)butanoic Acid-d3. Offered by: TRC. Available pack sizes: 25mg.
2-hydroxy-4-(trideuteriomethylsulfanyl)butanoic acid (CAS 2714417-29-3) is a chemical compound with the molecular formula C5H10O3S and a molecular weight of 153.22 g/mol. IUPAC name: 2-hydroxy-4-(trideuteriomethylsulfanyl)butanoic acid. InChIKey: ONFOSYPQQXJWGS-FIBGUPNXSA-N.
| Molecular formula | C5H10O3S |
|---|---|
| Molecular weight | 153.22 g/mol |
| IUPAC name | 2-hydroxy-4-(trideuteriomethylsulfanyl)butanoic acid |
| InChIKey | ONFOSYPQQXJWGS-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])SCCC(C(=O)O)O |
Computed by PubChem (NCBI)