cas: 5328-63-2 — see every product listed under this CAS number, including other names
(2R,3S,4R,5R)-2-Methoxytetrahydro-2H-pyran-3,4,5-triol, 99% (CAS 5328-63-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A245439-1g |
| cas | 5328-63-2 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 408.52 Pln | |
| AmBeed | 25g | 5824.84 Pln |
| purity | 99% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2R,3S,4R,5R)-2-methoxyoxane-3,4,5-triol (CAS 5328-63-2) is a chemical compound with the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. IUPAC name: (2R,3S,4R,5R)-2-methoxyoxane-3,4,5-triol. InChIKey: ZBDGHWFPLXXWRD-ARQDHWQXSA-N.
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (2R,3S,4R,5R)-2-methoxyoxane-3,4,5-triol |
| InChIKey | ZBDGHWFPLXXWRD-ARQDHWQXSA-N |
| SMILES | CO[C@H]1[C@H]([C@@H]([C@@H](CO1)O)O)O |
Computed by PubChem (NCBI)