CAS 3945-28-6 appears in our catalog under these names: Methyl Alpha-L-Arabinopyranoside, >95% (HPLC), Methyl a-L-arabinopyranoside. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 5mg, 1000mg, 500mg, 500000mg.
(2R,3R,4S,5S)-2-methoxyoxane-3,4,5-triol (CAS 3945-28-6) is a chemical compound with the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. IUPAC name: (2R,3R,4S,5S)-2-methoxyoxane-3,4,5-triol. InChIKey: ZBDGHWFPLXXWRD-UNTFVMJOSA-N.
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (2R,3R,4S,5S)-2-methoxyoxane-3,4,5-triol |
| InChIKey | ZBDGHWFPLXXWRD-UNTFVMJOSA-N |
| SMILES | CO[C@H]1[C@@H]([C@H]([C@H](CO1)O)O)O |
Computed by PubChem (NCBI)