cas: 752-13-6 — see every product listed under this CAS number, including other names
(2R,3S,4S)-5-(7,8-Dimethyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl)pentane-1,2,3,4-tetrayl tetraacetate, 95% (CAS 752-13-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F572160-100MG |
| cas | 752-13-6 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 497.76 Pln | |
| Fluorochem | 250mg | 758.08 Pln | |
| Fluorochem | 1g | 1955.58 Pln | |
| Fluorochem | 5g | 6464.41 Pln | |
| Ambeed | 250mg | 776.44 Pln | |
| Ambeed | 1g | 2066.94 Pln | |
| Ambeed | 5g | 7062.06 Pln | |
| Ambeed | 10g | 11256.19 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
[(2R,3S,4S)-2,3,4-triacetyloxy-5-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)pentyl] acetate (CAS 752-13-6) is a chemical compound with the molecular formula C25H28N4O10 and a molecular weight of 544.5 g/mol. IUPAC name: [(2R,3S,4S)-2,3,4-triacetyloxy-5-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)pentyl] acetate. InChIKey: VKVDYPHLGLIXAG-VWPQPMDRSA-N.
| Molecular formula | C25H28N4O10 |
|---|---|
| Molecular weight | 544.5 g/mol |
| IUPAC name | [(2R,3S,4S)-2,3,4-triacetyloxy-5-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)pentyl] acetate |
| InChIKey | VKVDYPHLGLIXAG-VWPQPMDRSA-N |
| SMILES | CC1=CC2=C(C=C1C)N(C3=NC(=O)NC(=O)C3=N2)C[C@@H]([C@@H]([C@@H](COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)