cas: 6633-22-3 — see every product listed under this CAS number, including other names
1-(4-Fluorophenyl)-pyrrole-2,5-dione, 98% (CAS 6633-22-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F015222-250MG |
| cas | 6633-22-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1205.84 Pln | |
| Fluorochem | 10g | 2195.08 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(4-fluorophenyl)pyrrole-2,5-dione (CAS 6633-22-3) is a chemical compound with the molecular formula C10H6FNO2 and a molecular weight of 191.16 g/mol. IUPAC name: 1-(4-fluorophenyl)pyrrole-2,5-dione. InChIKey: SBKKXWSZVVDOLR-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO2 |
|---|---|
| Molecular weight | 191.16 g/mol |
| IUPAC name | 1-(4-fluorophenyl)pyrrole-2,5-dione |
| InChIKey | SBKKXWSZVVDOLR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)C=CC2=O)F |
Computed by PubChem (NCBI)