cas: 1212688-40-8 — see every product listed under this CAS number, including other names
(2R,4S)-1-(tert-Butoxycarbonyl)-4-hydroxypiperidine-2-carboxylic acid 98% (CAS 1212688-40-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A393274-100mg |
| cas | 1212688-40-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 481.62 Pln | |
| Ambeed | 1g | 893.25 Pln | |
| Ambeed | 5g | 2945.81 Pln | |
| Ambeed | 10g | 4675.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A393274 |
(2R,4S)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid (CAS 1212688-40-8) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: (2R,4S)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid. InChIKey: GCAZZUFIDGXTDA-JGVFFNPUSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | (2R,4S)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid |
| InChIKey | GCAZZUFIDGXTDA-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C[C@@H]1C(=O)O)O |
Computed by PubChem (NCBI)