cas: 1212688-40-8 — see every product listed under this CAS number, including other names
(2R,4S)-1-[(tert-butoxy)carbonyl]-4-hydroxypiperidine-2-carboxylic acid, 97%, 97% (CAS 1212688-40-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110WK4-100mg |
| cas | 1212688-40-8 |
| size | 100mg |
| availability | 5.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 500mg | 410.00 Pln | |
| Chemat | 1g | 606.80 Pln | |
| Chemat | 5g | 1936.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R,4S)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid (CAS 1212688-40-8) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: (2R,4S)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid. InChIKey: GCAZZUFIDGXTDA-JGVFFNPUSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | (2R,4S)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid |
| InChIKey | GCAZZUFIDGXTDA-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C[C@@H]1C(=O)O)O |
Computed by PubChem (NCBI)