cas: 2380783-50-4 — see every product listed under this CAS number, including other names
(2R,4S)-1-(tert-Butoxycarbonyl)-4-phenoxypyrrolidine-2-carboxylic acid, 95%, 95% (CAS 2380783-50-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KLC3-100mg |
| cas | 2380783-50-4 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 419.60 Pln | |
| Chemat | 250mg | 654.80 Pln | |
| Chemat | 1g | 1586.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenoxypyrrolidine-2-carboxylic acid (CAS 2380783-50-4) is a chemical compound with the molecular formula C16H21NO5 and a molecular weight of 307.34 g/mol. IUPAC name: (2R,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenoxypyrrolidine-2-carboxylic acid. InChIKey: IQFZJNCETIGXIO-QWHCGFSZSA-N.
| Molecular formula | C16H21NO5 |
|---|---|
| Molecular weight | 307.34 g/mol |
| IUPAC name | (2R,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenoxypyrrolidine-2-carboxylic acid |
| InChIKey | IQFZJNCETIGXIO-QWHCGFSZSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@@H]1C(=O)O)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)